C14H13F3N2O4S — CID 38254434
N-(furan-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide (PubChem CID 38254434) has the molecular formula C14H13F3N2O4S and a molecular weight of 362.33 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 38254434 |
| Molecular Formula | C14H13F3N2O4S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1cccc(C(F)(F)F)c1)NCc1ccco1 |
| InChI | InChI=1S/C14H13F3N2O4S/c15-14(16,17)10-3-1-5-12(7-10)24(21,22)19-9-13(20)18-8-11-4-2-6-23-11/h1-7,19H,8-9H2,(H,18,20) |
| InChIKey | KJMPMDJPRZXLOX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |