C19H18N2O4S — CID 87024650
N-(furan-2-ylmethyl)-2-[(4-phenylphenyl)sulfonylamino]acetamide (PubChem CID 87024650) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(4-phenylphenyl)sulfonylamino]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[(4-phenylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 87024650 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(4-phenylphenyl)sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(-c2ccccc2)cc1)NCc1ccco1 |
| InChI | InChI=1S/C19H18N2O4S/c22-19(20-13-17-7-4-12-25-17)14-21-26(23,24)18-10-8-16(9-11-18)15-5-2-1-3-6-15/h1-12,21H,13-14H2,(H,20,22) |
| InChIKey | HLWOBBAFJUWFDL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |