C14H15N3O6S — CID 86989267
N-(furan-2-ylmethyl)-2-[(2-methyl-6-nitrophenyl)sulfonylamino]acetamide (PubChem CID 86989267) has the molecular formula C14H15N3O6S and a molecular weight of 353.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(2-methyl-6-nitrophenyl)sulfonylamino]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[(2-methyl-6-nitrophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 86989267 |
| Molecular Formula | C14H15N3O6S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(2-methyl-6-nitrophenyl)sulfonylamino]acetamide |
| SMILES | Cc1cccc([N+](=O)[O-])c1S(=O)(=O)NCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H15N3O6S/c1-10-4-2-6-12(17(19)20)14(10)24(21,22)16-9-13(18)15-8-11-5-3-7-23-11/h2-7,16H,8-9H2,1H3,(H,15,18) |
| InChIKey | RTBXEFMPSWLSIJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|