C12H14N2O4S2 — CID 38254483
N-(furan-2-ylmethyl)-2-[(5-methylthiophen-2-yl)sulfonylamino]acetamide (PubChem CID 38254483) has the molecular formula C12H14N2O4S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(5-methylthiophen-2-yl)sulfonylamino]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[(5-methylthiophen-2-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 38254483 |
| Molecular Formula | C12H14N2O4S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(5-methylthiophen-2-yl)sulfonylamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)NCc2ccco2)s1 |
| InChI | InChI=1S/C12H14N2O4S2/c1-9-4-5-12(19-9)20(16,17)14-8-11(15)13-7-10-3-2-6-18-10/h2-6,14H,7-8H2,1H3,(H,13,15) |
| InChIKey | FNFYUMOZHUQQSE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |