C16H22N2O4S2 — CID 110349246
(2S)-2-[(5-ethylthiophen-2-yl)sulfonylamino]-N-(furan-2-ylmethyl)-3-methylbutanamide (PubChem CID 110349246) has the molecular formula C16H22N2O4S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is (2S)-2-[(5-ethylthiophen-2-yl)sulfonylamino]-N-(furan-2-ylmethyl)-3-methylbutanamide.
| Compound Name | (2S)-2-[(5-ethylthiophen-2-yl)sulfonylamino]-N-(furan-2-ylmethyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 110349246 |
| Molecular Formula | C16H22N2O4S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (2S)-2-[(5-ethylthiophen-2-yl)sulfonylamino]-N-(furan-2-ylmethyl)-3-methylbutanamide |
| SMILES | CCc1ccc(S(=O)(=O)N[C@H](C(=O)NCc2ccco2)C(C)C)s1 |
| InChI | InChI=1S/C16H22N2O4S2/c1-4-13-7-8-14(23-13)24(20,21)18-15(11(2)3)16(19)17-10-12-6-5-9-22-12/h5-9,11,15,18H,4,10H2,1-3H3,(H,17,19)/t15-/m0/s1 |
| InChIKey | HDFVHCCXCAIWOE-HNNXBMFYSA-N |
| XLogP | 2.52 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |