C14H18N2O4S2 — CID 41111102
(2S)-N-(furan-2-ylmethyl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide (PubChem CID 41111102) has the molecular formula C14H18N2O4S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2S)-N-(furan-2-ylmethyl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide.
| Compound Name | (2S)-N-(furan-2-ylmethyl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 41111102 |
| Molecular Formula | C14H18N2O4S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (2S)-N-(furan-2-ylmethyl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1cccs1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H18N2O4S2/c1-10(2)13(14(17)15-9-11-5-3-7-20-11)16-22(18,19)12-6-4-8-21-12/h3-8,10,13,16H,9H2,1-2H3,(H,15,17)/t13-/m0/s1 |
| InChIKey | OHHNUHRXVAGSHJ-ZDUSSCGKSA-N |
| XLogP | 1.96 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |