C13H22N2O4S2 — CID 41111123
(2R)-N-(3-methoxypropyl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide (PubChem CID 41111123) has the molecular formula C13H22N2O4S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is (2R)-N-(3-methoxypropyl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide.
| Compound Name | (2R)-N-(3-methoxypropyl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 41111123 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (2R)-N-(3-methoxypropyl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide |
| SMILES | COCCCNC(=O)[C@H](NS(=O)(=O)c1cccs1)C(C)C |
| InChI | InChI=1S/C13H22N2O4S2/c1-10(2)12(13(16)14-7-5-8-19-3)15-21(17,18)11-6-4-9-20-11/h4,6,9-10,12,15H,5,7-8H2,1-3H3,(H,14,16)/t12-/m1/s1 |
| InChIKey | XPHUNYLEYCUWEG-GFCCVEGCSA-N |
| XLogP | 1.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|