C20H29N3O3S2 — CID 29296315
(2S)-N-[3-[benzyl(methyl)amino]propyl]-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide (PubChem CID 29296315) has the molecular formula C20H29N3O3S2 and a molecular weight of 423.60 g/mol. Its IUPAC name is (2S)-N-[3-[benzyl(methyl)amino]propyl]-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide.
| Compound Name | (2S)-N-[3-[benzyl(methyl)amino]propyl]-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 29296315 |
| Molecular Formula | C20H29N3O3S2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (2S)-N-[3-[benzyl(methyl)amino]propyl]-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1cccs1)C(=O)NCCCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C20H29N3O3S2/c1-16(2)19(22-28(25,26)18-11-7-14-27-18)20(24)21-12-8-13-23(3)15-17-9-5-4-6-10-17/h4-7,9-11,14,16,19,22H,8,12-13,15H2,1-3H3,(H,21,24)/t19-/m0/s1 |
| InChIKey | XTUXZAQWAMJWOP-IBGZPJMESA-N |
| XLogP | 2.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|