C17H22N2O3S2 — CID 15999915
N-(3-ethylphenyl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide (PubChem CID 15999915) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-(3-ethylphenyl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide.
| Compound Name | N-(3-ethylphenyl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 15999915 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-(3-ethylphenyl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide |
| SMILES | CCc1cccc(NC(=O)C(NS(=O)(=O)c2cccs2)C(C)C)c1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-4-13-7-5-8-14(11-13)18-17(20)16(12(2)3)19-24(21,22)15-9-6-10-23-15/h5-12,16,19H,4H2,1-3H3,(H,18,20) |
| InChIKey | KWHAKYWTPMXTCM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |