C16H20N2O3S2 — CID 26873900
(2R)-N-benzyl-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide (PubChem CID 26873900) has the molecular formula C16H20N2O3S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (2R)-N-benzyl-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide.
| Compound Name | (2R)-N-benzyl-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 26873900 |
| Molecular Formula | C16H20N2O3S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (2R)-N-benzyl-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1cccs1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C16H20N2O3S2/c1-12(2)15(18-23(20,21)14-9-6-10-22-14)16(19)17-11-13-7-4-3-5-8-13/h3-10,12,15,18H,11H2,1-2H3,(H,17,19)/t15-/m1/s1 |
| InChIKey | DPJOHZHKXFAHKN-OAHLLOKOSA-N |
| XLogP | 2.37 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |