C13H13IN2O3S2 — CID 55645413
N-(3-iodophenyl)-2-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 55645413) has the molecular formula C13H13IN2O3S2 and a molecular weight of 436.30 g/mol. Its IUPAC name is N-(3-iodophenyl)-2-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-(3-iodophenyl)-2-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 55645413 |
| Molecular Formula | C13H13IN2O3S2 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.94 |
| IUPAC Name | N-(3-iodophenyl)-2-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | CC(NS(=O)(=O)c1cccs1)C(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C13H13IN2O3S2/c1-9(16-21(18,19)12-6-3-7-20-12)13(17)15-11-5-2-4-10(14)8-11/h2-9,16H,1H3,(H,15,17) |
| InChIKey | SIACBFVYQCAYCU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|