C17H18N4O3S2 — CID 55970450
N-[4-(pyrazol-1-ylmethyl)phenyl]-2-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 55970450) has the molecular formula C17H18N4O3S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-[4-(pyrazol-1-ylmethyl)phenyl]-2-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-[4-(pyrazol-1-ylmethyl)phenyl]-2-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 55970450 |
| Molecular Formula | C17H18N4O3S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-[4-(pyrazol-1-ylmethyl)phenyl]-2-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | CC(NS(=O)(=O)c1cccs1)C(=O)Nc1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C17H18N4O3S2/c1-13(20-26(23,24)16-4-2-11-25-16)17(22)19-15-7-5-14(6-8-15)12-21-10-3-9-18-21/h2-11,13,20H,12H2,1H3,(H,19,22) |
| InChIKey | SDPFHGFWDPRDJQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |