C17H22N2O6S2 — CID 55911805
N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-2-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 55911805) has the molecular formula C17H22N2O6S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-2-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-2-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 55911805 |
| Molecular Formula | C17H22N2O6S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-2-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | COCCOc1cc(NC(=O)C(C)NS(=O)(=O)c2cccs2)ccc1OC |
| InChI | InChI=1S/C17H22N2O6S2/c1-12(19-27(21,22)16-5-4-10-26-16)17(20)18-13-6-7-14(24-3)15(11-13)25-9-8-23-2/h4-7,10-12,19H,8-9H2,1-3H3,(H,18,20) |
| InChIKey | SGBMDZPYOXJWBO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|