C20H20N4O4S2 — CID 55965030
N-(pyridin-2-ylmethyl)-3-[2-(thiophen-2-ylsulfonylamino)propanoylamino]benzamide (PubChem CID 55965030) has the molecular formula C20H20N4O4S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-3-[2-(thiophen-2-ylsulfonylamino)propanoylamino]benzamide.
| Compound Name | N-(pyridin-2-ylmethyl)-3-[2-(thiophen-2-ylsulfonylamino)propanoylamino]benzamide |
|---|---|
| PubChem CID | 55965030 |
| Molecular Formula | C20H20N4O4S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-3-[2-(thiophen-2-ylsulfonylamino)propanoylamino]benzamide |
| SMILES | CC(NS(=O)(=O)c1cccs1)C(=O)Nc1cccc(C(=O)NCc2ccccn2)c1 |
| InChI | InChI=1S/C20H20N4O4S2/c1-14(24-30(27,28)18-9-5-11-29-18)19(25)23-16-8-4-6-15(12-16)20(26)22-13-17-7-2-3-10-21-17/h2-12,14,24H,13H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | GABCNTXWKZMWLQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |