C22H22N4O5S — CID 55964388
4-methoxy-3-(methylsulfamoyl)-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]benzamide (PubChem CID 55964388) has the molecular formula C22H22N4O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is 4-methoxy-3-(methylsulfamoyl)-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]benzamide.
| Compound Name | 4-methoxy-3-(methylsulfamoyl)-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55964388 |
| Molecular Formula | C22H22N4O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 4-methoxy-3-(methylsulfamoyl)-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)Nc2cccc(C(=O)NCc3ccccn3)c2)ccc1OC |
| InChI | InChI=1S/C22H22N4O5S/c1-23-32(29,30)20-13-16(9-10-19(20)31-2)22(28)26-17-8-5-6-15(12-17)21(27)25-14-18-7-3-4-11-24-18/h3-13,23H,14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | MTTVWSYOXMAZJV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |