C16H19N3O6S2 — CID 55914783
N-[1-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-1-oxopropan-2-yl]thiophene-2-sulfonamide (PubChem CID 55914783) has the molecular formula C16H19N3O6S2 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[1-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-1-oxopropan-2-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-1-oxopropan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55914783 |
| Molecular Formula | C16H19N3O6S2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | N-[1-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-1-oxopropan-2-yl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(C(=O)NNC(=O)C(C)NS(=O)(=O)c2cccs2)cc1OC |
| InChI | InChI=1S/C16H19N3O6S2/c1-10(19-27(22,23)14-5-4-8-26-14)15(20)17-18-16(21)11-6-7-12(24-2)13(9-11)25-3/h4-10,19H,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | IIDIGCNDHYRZPW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|