C14H17NO4S2 — CID 7028776
N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]thiophene-2-sulfonamide (PubChem CID 7028776) has the molecular formula C14H17NO4S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 7028776 |
| Molecular Formula | C14H17NO4S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc(OC)c([C@H](C)NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C14H17NO4S2/c1-10(15-21(16,17)14-5-4-8-20-14)12-9-11(18-2)6-7-13(12)19-3/h4-10,15H,1-3H3/t10-/m0/s1 |
| InChIKey | GJUDLWMWJAXYGL-JTQLQIEISA-N |
| XLogP | 2.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |