C17H18N2O4S — CID 9190439
4-cyano-N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]benzenesulfonamide (PubChem CID 9190439) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 4-cyano-N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9190439 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-cyano-N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c([C@H](C)NS(=O)(=O)c2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C17H18N2O4S/c1-12(16-10-14(22-2)6-9-17(16)23-3)19-24(20,21)15-7-4-13(11-18)5-8-15/h4-10,12,19H,1-3H3/t12-/m0/s1 |
| InChIKey | SWEFYABUHBSECV-LBPRGKRZSA-N |
| XLogP | 2.61 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |