C11H17NO4S — CID 51389866
N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]methanesulfonamide (PubChem CID 51389866) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]methanesulfonamide.
| Compound Name | N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 51389866 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]methanesulfonamide |
| SMILES | COc1ccc(OC)c([C@@H](C)NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C11H17NO4S/c1-8(12-17(4,13)14)10-7-9(15-2)5-6-11(10)16-3/h5-8,12H,1-4H3/t8-/m1/s1 |
| InChIKey | ZXVCKBWPJDEQIH-MRVPVSSYSA-N |
| XLogP | 1.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |