C11H17NO2 — CID 40516621
(1S)-1-(2,5-dimethoxyphenyl)-N-methylethanamine (PubChem CID 40516621) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (1S)-1-(2,5-dimethoxyphenyl)-N-methylethanamine.
| Compound Name | (1S)-1-(2,5-dimethoxyphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 40516621 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (1S)-1-(2,5-dimethoxyphenyl)-N-methylethanamine |
| SMILES | CN[C@@H](C)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C11H17NO2/c1-8(12-2)10-7-9(13-3)5-6-11(10)14-4/h5-8,12H,1-4H3/t8-/m0/s1 |
| InChIKey | NARFMHRYFHYPBT-QMMMGPOBSA-N |
| XLogP | 1.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |