C11H18N2O2 — CID 116954299
1-(2,5-dimethoxyphenyl)-N,N'-dimethylmethanediamine (PubChem CID 116954299) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-N,N'-dimethylmethanediamine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 116954299 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-N,N'-dimethylmethanediamine |
| SMILES | CNC(NC)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C11H18N2O2/c1-12-11(13-2)9-7-8(14-3)5-6-10(9)15-4/h5-7,11-13H,1-4H3 |
| InChIKey | UNKLGDZQOMKUAC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|