C11H18N2O2 — CID 116932428
1-(2,5-dimethoxyphenyl)-N'-methylethane-1,2-diamine (PubChem CID 116932428) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-N'-methylethane-1,2-diamine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 116932428 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-N'-methylethane-1,2-diamine |
| SMILES | CNCC(N)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C11H18N2O2/c1-13-7-10(12)9-6-8(14-2)4-5-11(9)15-3/h4-6,10,13H,7,12H2,1-3H3 |
| InChIKey | DZYWDJPTGKEVPO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |