C12H17NO5 — CID 61327016
2-[2-amino-2-(2,5-dimethoxyphenyl)ethoxy]acetic acid (PubChem CID 61327016) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-[2-amino-2-(2,5-dimethoxyphenyl)ethoxy]acetic acid.
| Compound Name | 2-[2-amino-2-(2,5-dimethoxyphenyl)ethoxy]acetic acid |
|---|---|
| PubChem CID | 61327016 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-[2-amino-2-(2,5-dimethoxyphenyl)ethoxy]acetic acid |
| SMILES | COc1ccc(OC)c(C(N)COCC(=O)O)c1 |
| InChI | InChI=1S/C12H17NO5/c1-16-8-3-4-11(17-2)9(5-8)10(13)6-18-7-12(14)15/h3-5,10H,6-7,13H2,1-2H3,(H,14,15) |
| InChIKey | GDSSFDUMOMEDQV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |