C13H16O6 — CID 94278774
dimethyl 2-(2,5-dimethoxyphenyl)propanedioate (PubChem CID 94278774) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is dimethyl 2-(2,5-dimethoxyphenyl)propanedioate.
| Compound Name | dimethyl 2-(2,5-dimethoxyphenyl)propanedioate |
|---|---|
| PubChem CID | 94278774 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | dimethyl 2-(2,5-dimethoxyphenyl)propanedioate |
| SMILES | COC(=O)C(C(=O)OC)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H16O6/c1-16-8-5-6-10(17-2)9(7-8)11(12(14)18-3)13(15)19-4/h5-7,11H,1-4H3 |
| InChIKey | MHABOHVWQKSVCH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|