dimethyl 2-(2,5-dimethoxyphenyl)propanedioate

C13H16O6 — CID 94278774

IUPACdimethyl 2-(2,5-dimethoxyphenyl)propanedioate
SMILESCOC(=O)C(C(=O)OC)c1cc(OC)ccc1OC
InChIInChI=1S/C13H16O6/c1-16-8-5-6-10(17-2)9(7-8)11(12(14)18-3)13(15)19-4/h5-7,11H,1-4H3
InChIKeyMHABOHVWQKSVCH-UHFFFAOYSA-N
MW268.26 g/mol
LogP1.13
Rot. Bonds5

About dimethyl 2-(2,5-dimethoxyphenyl)propanedioate

dimethyl 2-(2,5-dimethoxyphenyl)propanedioate (PubChem CID 94278774) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is dimethyl 2-(2,5-dimethoxyphenyl)propanedioate.

Molecular Properties

Compound Namedimethyl 2-(2,5-dimethoxyphenyl)propanedioate
PubChem CID94278774
Molecular FormulaC13H16O6
Molecular Weight268.26 g/mol
Exact Mass268.09
IUPAC Namedimethyl 2-(2,5-dimethoxyphenyl)propanedioate
SMILESCOC(=O)C(C(=O)OC)c1cc(OC)ccc1OC
InChIInChI=1S/C13H16O6/c1-16-8-5-6-10(17-2)9(7-8)11(12(14)18-3)13(15)19-4/h5-7,11H,1-4H3
InChIKeyMHABOHVWQKSVCH-UHFFFAOYSA-N
XLogP1.13
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.26
LogP ≤ 51.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze dimethyl 2-(2,5-dimethoxyphenyl)propanedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dimethyl 2-(2,5-dimethoxyphenyl)propanedioate?
The IUPAC name of dimethyl 2-(2,5-dimethoxyphenyl)propanedioate (CID 94278774) is dimethyl 2-(2,5-dimethoxyphenyl)propanedioate.
What is the SMILES notation for dimethyl 2-(2,5-dimethoxyphenyl)propanedioate?
The canonical SMILES for dimethyl 2-(2,5-dimethoxyphenyl)propanedioate is COC(=O)C(C(=O)OC)c1cc(OC)ccc1OC.
What is the InChIKey of dimethyl 2-(2,5-dimethoxyphenyl)propanedioate?
The InChIKey is MHABOHVWQKSVCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O6/c1-16-8-5-6-10(17-2)9(7-8)11(12(14)18-3)13(15)19-4/h5-7,11H,1-4H3.
What are the key properties of dimethyl 2-(2,5-dimethoxyphenyl)propanedioate?
dimethyl 2-(2,5-dimethoxyphenyl)propanedioate has a molecular weight of 268.26 g/mol, XLogP of 1.13, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-(2,5-dimethoxyphenyl)propanedioate is sourced from PubChem (CID 94278774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).