C14H20O5 — CID 62395093
methyl 2-[(2,5-dimethoxyphenyl)-hydroxymethyl]butanoate (PubChem CID 62395093) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl 2-[(2,5-dimethoxyphenyl)-hydroxymethyl]butanoate.
| Compound Name | methyl 2-[(2,5-dimethoxyphenyl)-hydroxymethyl]butanoate |
|---|---|
| PubChem CID | 62395093 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | methyl 2-[(2,5-dimethoxyphenyl)-hydroxymethyl]butanoate |
| SMILES | CCC(C(=O)OC)C(O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C14H20O5/c1-5-10(14(16)19-4)13(15)11-8-9(17-2)6-7-12(11)18-3/h6-8,10,13,15H,5H2,1-4H3 |
| InChIKey | ORLFYSFBPNEDPR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |