C14H21NO5 — CID 82348735
4-(2,5-dimethoxyphenyl)-3-(ethylamino)-4-hydroxybutanoic acid (PubChem CID 82348735) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-3-(ethylamino)-4-hydroxybutanoic acid.
| Compound Name | 4-(2,5-dimethoxyphenyl)-3-(ethylamino)-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 82348735 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-3-(ethylamino)-4-hydroxybutanoic acid |
| SMILES | CCNC(CC(=O)O)C(O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C14H21NO5/c1-4-15-11(8-13(16)17)14(18)10-7-9(19-2)5-6-12(10)20-3/h5-7,11,14-15,18H,4,8H2,1-3H3,(H,16,17) |
| InChIKey | JHMGFQXXROSFEO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |