C16H25NO4 — CID 94666737
(2S)-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-2-ethoxybutanamide (PubChem CID 94666737) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-2-ethoxybutanamide.
| Compound Name | (2S)-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-2-ethoxybutanamide |
|---|---|
| PubChem CID | 94666737 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (2S)-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-2-ethoxybutanamide |
| SMILES | CCO[C@@H](CC)C(=O)N[C@H](C)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H25NO4/c1-6-14(21-7-2)16(18)17-11(3)13-10-12(19-4)8-9-15(13)20-5/h8-11,14H,6-7H2,1-5H3,(H,17,18)/t11-,14+/m1/s1 |
| InChIKey | XOKXNBCOWOHMPH-RISCZKNCSA-N |
| XLogP | 2.70 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |