C17H27NO3S — CID 134037876
2-butylsulfanyl-N-[1-(2,5-dimethoxyphenyl)ethyl]propanamide (PubChem CID 134037876) has the molecular formula C17H27NO3S and a molecular weight of 325.47 g/mol. Its IUPAC name is 2-butylsulfanyl-N-[1-(2,5-dimethoxyphenyl)ethyl]propanamide.
| Compound Name | 2-butylsulfanyl-N-[1-(2,5-dimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 134037876 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 2-butylsulfanyl-N-[1-(2,5-dimethoxyphenyl)ethyl]propanamide |
| SMILES | CCCCSC(C)C(=O)NC(C)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C17H27NO3S/c1-6-7-10-22-13(3)17(19)18-12(2)15-11-14(20-4)8-9-16(15)21-5/h8-9,11-13H,6-7,10H2,1-5H3,(H,18,19) |
| InChIKey | JKXZXBSIZDUKBG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|