C22H27NO5 — CID 9477089
N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-(4-ethoxyphenyl)-4-oxobutanamide (PubChem CID 9477089) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-(4-ethoxyphenyl)-4-oxobutanamide.
| Compound Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-(4-ethoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 9477089 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-(4-ethoxyphenyl)-4-oxobutanamide |
| SMILES | CCOc1ccc(C(=O)CCC(=O)N[C@@H](C)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C22H27NO5/c1-5-28-17-8-6-16(7-9-17)20(24)11-13-22(25)23-15(2)19-14-18(26-3)10-12-21(19)27-4/h6-10,12,14-15H,5,11,13H2,1-4H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | IPWPZGYTGITPHX-HNNXBMFYSA-N |
| XLogP | 3.94 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |