methyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate

C13H18O5 — CID 66289214

IUPACmethyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate
SMILESCOC(=O)C(O)C(C)c1cc(OC)ccc1OC
InChIInChI=1S/C13H18O5/c1-8(12(14)13(15)18-4)10-7-9(16-2)5-6-11(10)17-3/h5-8,12,14H,1-4H3
InChIKeyOTGDWDWYZSOJTQ-UHFFFAOYSA-N
MW254.28 g/mol
LogP1.34
Rot. Bonds5

About methyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate

methyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate (PubChem CID 66289214) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is methyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate.

Molecular Properties

Compound Namemethyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate
PubChem CID66289214
Molecular FormulaC13H18O5
Molecular Weight254.28 g/mol
Exact Mass254.12
IUPAC Namemethyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate
SMILESCOC(=O)C(O)C(C)c1cc(OC)ccc1OC
InChIInChI=1S/C13H18O5/c1-8(12(14)13(15)18-4)10-7-9(16-2)5-6-11(10)17-3/h5-8,12,14H,1-4H3
InChIKeyOTGDWDWYZSOJTQ-UHFFFAOYSA-N
XLogP1.34
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.28
LogP ≤ 51.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate?
The IUPAC name of methyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate (CID 66289214) is methyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate.
What is the SMILES notation for methyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate?
The canonical SMILES for methyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate is COC(=O)C(O)C(C)c1cc(OC)ccc1OC.
What is the InChIKey of methyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate?
The InChIKey is OTGDWDWYZSOJTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O5/c1-8(12(14)13(15)18-4)10-7-9(16-2)5-6-11(10)17-3/h5-8,12,14H,1-4H3.
What are the key properties of methyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate?
methyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate has a molecular weight of 254.28 g/mol, XLogP of 1.34, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,5-dimethoxyphenyl)-2-hydroxybutanoate is sourced from PubChem (CID 66289214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).