C16H25NO4 — CID 69267988
2-(aminomethyl)-5-(2,5-dimethoxyphenyl)-4-methylhexanoic acid (PubChem CID 69267988) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-(aminomethyl)-5-(2,5-dimethoxyphenyl)-4-methylhexanoic acid.
| Compound Name | 2-(aminomethyl)-5-(2,5-dimethoxyphenyl)-4-methylhexanoic acid |
|---|---|
| PubChem CID | 69267988 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-(aminomethyl)-5-(2,5-dimethoxyphenyl)-4-methylhexanoic acid |
| SMILES | COc1ccc(OC)c(C(C)C(C)CC(CN)C(=O)O)c1 |
| InChI | InChI=1S/C16H25NO4/c1-10(7-12(9-17)16(18)19)11(2)14-8-13(20-3)5-6-15(14)21-4/h5-6,8,10-12H,7,9,17H2,1-4H3,(H,18,19) |
| InChIKey | HXAVEKFUSRQTGI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |