C17H27NO4 — CID 69269674
2-(aminomethyl)-7-(2,5-dimethoxyphenyl)-4-methylheptanoic acid (PubChem CID 69269674) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-(aminomethyl)-7-(2,5-dimethoxyphenyl)-4-methylheptanoic acid.
| Compound Name | 2-(aminomethyl)-7-(2,5-dimethoxyphenyl)-4-methylheptanoic acid |
|---|---|
| PubChem CID | 69269674 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-(aminomethyl)-7-(2,5-dimethoxyphenyl)-4-methylheptanoic acid |
| SMILES | COc1ccc(OC)c(CCCC(C)CC(CN)C(=O)O)c1 |
| InChI | InChI=1S/C17H27NO4/c1-12(9-14(11-18)17(19)20)5-4-6-13-10-15(21-2)7-8-16(13)22-3/h7-8,10,12,14H,4-6,9,11,18H2,1-3H3,(H,19,20) |
| InChIKey | MLEDZVLOFCLOSZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |