C15H23NO4 — CID 69266992
2-(aminomethyl)-7-(2,5-dihydroxyphenyl)-4-methylheptanoic acid (PubChem CID 69266992) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-(aminomethyl)-7-(2,5-dihydroxyphenyl)-4-methylheptanoic acid.
| Compound Name | 2-(aminomethyl)-7-(2,5-dihydroxyphenyl)-4-methylheptanoic acid |
|---|---|
| PubChem CID | 69266992 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-(aminomethyl)-7-(2,5-dihydroxyphenyl)-4-methylheptanoic acid |
| SMILES | CC(CCCc1cc(O)ccc1O)CC(CN)C(=O)O |
| InChI | InChI=1S/C15H23NO4/c1-10(7-12(9-16)15(19)20)3-2-4-11-8-13(17)5-6-14(11)18/h5-6,8,10,12,17-18H,2-4,7,9,16H2,1H3,(H,19,20) |
| InChIKey | ZYVQTGFMFKMNDF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|