C26H46O2 — CID 10385750
2-(3,7,11,15-tetramethylhexadecyl)benzene-1,4-diol (PubChem CID 10385750) has the molecular formula C26H46O2 and a molecular weight of 390.65 g/mol. Its IUPAC name is 2-(3,7,11,15-tetramethylhexadecyl)benzene-1,4-diol.
| Compound Name | 2-(3,7,11,15-tetramethylhexadecyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 10385750 |
| Molecular Formula | C26H46O2 |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 390.35 |
| IUPAC Name | 2-(3,7,11,15-tetramethylhexadecyl)benzene-1,4-diol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCc1cc(O)ccc1O |
| InChI | InChI=1S/C26H46O2/c1-20(2)9-6-10-21(3)11-7-12-22(4)13-8-14-23(5)15-16-24-19-25(27)17-18-26(24)28/h17-23,27-28H,6-16H2,1-5H3 |
| InChIKey | QBNNFBSVSBMOLB-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|