C24H42O — CID 152684433
4-(6,10,14-trimethylpentadecyl)phenol (PubChem CID 152684433) has the molecular formula C24H42O and a molecular weight of 346.60 g/mol. Its IUPAC name is 4-(6,10,14-trimethylpentadecyl)phenol.
| Compound Name | 4-(6,10,14-trimethylpentadecyl)phenol |
|---|---|
| PubChem CID | 152684433 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | 4-(6,10,14-trimethylpentadecyl)phenol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C24H42O/c1-20(2)10-8-12-22(4)14-9-13-21(3)11-6-5-7-15-23-16-18-24(25)19-17-23/h16-22,25H,5-15H2,1-4H3 |
| InChIKey | ZOFXYZOBTXQBSM-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|