C26H46 — CID 94774977
1,4-bis[(3R)-3,7-dimethyloctyl]benzene (PubChem CID 94774977) has the molecular formula C26H46 and a molecular weight of 358.65 g/mol. Its IUPAC name is 1,4-bis[(3R)-3,7-dimethyloctyl]benzene.
| Compound Name | 1,4-bis[(3R)-3,7-dimethyloctyl]benzene |
|---|---|
| PubChem CID | 94774977 |
| Molecular Formula | C26H46 |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 358.36 |
| IUPAC Name | 1,4-bis[(3R)-3,7-dimethyloctyl]benzene |
| SMILES | CC(C)CCC[C@@H](C)CCc1ccc(CC[C@H](C)CCCC(C)C)cc1 |
| InChI | InChI=1S/C26H46/c1-21(2)9-7-11-23(5)13-15-25-17-19-26(20-18-25)16-14-24(6)12-8-10-22(3)4/h17-24H,7-16H2,1-6H3/t23-,24-/m1/s1 |
| InChIKey | XTDSXTPHPOPBPO-DNQXCXABSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |