C17H25F3 — CID 177308905
1-(3,7-dimethyloctyl)-3-(trifluoromethyl)benzene (PubChem CID 177308905) has the molecular formula C17H25F3 and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-(3,7-dimethyloctyl)-3-(trifluoromethyl)benzene.
| Compound Name | 1-(3,7-dimethyloctyl)-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 177308905 |
| Molecular Formula | C17H25F3 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 1-(3,7-dimethyloctyl)-3-(trifluoromethyl)benzene |
| SMILES | CC(C)CCCC(C)CCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H25F3/c1-13(2)6-4-7-14(3)10-11-15-8-5-9-16(12-15)17(18,19)20/h5,8-9,12-14H,4,6-7,10-11H2,1-3H3 |
| InChIKey | OVEKDNNGHONRMO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |