C10H10F3NaO4S — CID 134860445
sodium 1-hydroxy-3-[3-(trifluoromethyl)phenyl]propane-1-sulfonate (PubChem CID 134860445) has the molecular formula C10H10F3NaO4S and a molecular weight of 306.24 g/mol. Its IUPAC name is sodium 1-hydroxy-3-[3-(trifluoromethyl)phenyl]propane-1-sulfonate.
| Compound Name | sodium 1-hydroxy-3-[3-(trifluoromethyl)phenyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 134860445 |
| Molecular Formula | C10H10F3NaO4S |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | sodium 1-hydroxy-3-[3-(trifluoromethyl)phenyl]propane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(O)CCc1cccc(C(F)(F)F)c1.[Na+] |
| InChI | InChI=1S/C10H11F3O4S.Na/c11-10(12,13)8-3-1-2-7(6-8)4-5-9(14)18(15,16)17;/h1-3,6,9,14H,4-5H2,(H,15,16,17);/q;+1/p-1 |
| InChIKey | MUKKEJYKCOFGMF-UHFFFAOYSA-M |
| XLogP | -1.49 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|