C13H19ClF3NO — CID 174355775
3-(aminomethyl)-5-[3-(trifluoromethyl)phenyl]pentan-1-ol;hydrochloride (PubChem CID 174355775) has the molecular formula C13H19ClF3NO and a molecular weight of 297.75 g/mol. Its IUPAC name is 3-(aminomethyl)-5-[3-(trifluoromethyl)phenyl]pentan-1-ol;hydrochloride.
| Compound Name | 3-(aminomethyl)-5-[3-(trifluoromethyl)phenyl]pentan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 174355775 |
| Molecular Formula | C13H19ClF3NO |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-(aminomethyl)-5-[3-(trifluoromethyl)phenyl]pentan-1-ol;hydrochloride |
| SMILES | Cl.NCC(CCO)CCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NO.ClH/c14-13(15,16)12-3-1-2-10(8-12)4-5-11(9-17)6-7-18;/h1-3,8,11,18H,4-7,9,17H2;1H |
| InChIKey | NZBJWYLLTZKXNP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |