C22H25F6NO3 — CID 141226108
2-[2-[3-amino-5-(trifluoromethyl)-4-[3-[3-(trifluoromethyl)phenyl]propoxy]phenyl]ethyl]propane-1,3-diol (PubChem CID 141226108) has the molecular formula C22H25F6NO3 and a molecular weight of 465.43 g/mol. Its IUPAC name is 2-[2-[3-amino-5-(trifluoromethyl)-4-[3-[3-(trifluoromethyl)phenyl]propoxy]phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-[2-[3-amino-5-(trifluoromethyl)-4-[3-[3-(trifluoromethyl)phenyl]propoxy]phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 141226108 |
| Molecular Formula | C22H25F6NO3 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-[2-[3-amino-5-(trifluoromethyl)-4-[3-[3-(trifluoromethyl)phenyl]propoxy]phenyl]ethyl]propane-1,3-diol |
| SMILES | Nc1cc(CCC(CO)CO)cc(C(F)(F)F)c1OCCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H25F6NO3/c23-21(24,25)17-5-1-3-14(9-17)4-2-8-32-20-18(22(26,27)28)10-15(11-19(20)29)6-7-16(12-30)13-31/h1,3,5,9-11,16,30-31H,2,4,6-8,12-13,29H2 |
| InChIKey | GHBSBJDBCKQQIC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|