C11H15F3O3Si — CID 90173460
dihydroxy-methoxy-[3-[3-(trifluoromethyl)phenyl]propyl]silane (PubChem CID 90173460) has the molecular formula C11H15F3O3Si and a molecular weight of 280.32 g/mol. Its IUPAC name is dihydroxy-methoxy-[3-[3-(trifluoromethyl)phenyl]propyl]silane.
| Compound Name | dihydroxy-methoxy-[3-[3-(trifluoromethyl)phenyl]propyl]silane |
|---|---|
| PubChem CID | 90173460 |
| Molecular Formula | C11H15F3O3Si |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | dihydroxy-methoxy-[3-[3-(trifluoromethyl)phenyl]propyl]silane |
| SMILES | CO[Si](O)(O)CCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H15F3O3Si/c1-17-18(15,16)7-3-5-9-4-2-6-10(8-9)11(12,13)14/h2,4,6,8,15-16H,3,5,7H2,1H3 |
| InChIKey | DBSHLSKSCVFIGN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|