C14H18F6O2Si — CID 90172351
3-[3,5-bis(trifluoromethyl)phenyl]propyl-dimethoxy-methylsilane (PubChem CID 90172351) has the molecular formula C14H18F6O2Si and a molecular weight of 360.37 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]propyl-dimethoxy-methylsilane.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]propyl-dimethoxy-methylsilane |
|---|---|
| PubChem CID | 90172351 |
| Molecular Formula | C14H18F6O2Si |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]propyl-dimethoxy-methylsilane |
| SMILES | CO[Si](C)(CCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OC |
| InChI | InChI=1S/C14H18F6O2Si/c1-21-23(3,22-2)6-4-5-10-7-11(13(15,16)17)9-12(8-10)14(18,19)20/h7-9H,4-6H2,1-3H3 |
| InChIKey | OVIXGLZPPLIGCI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|