C18H20F6O6Si — CID 90173511
[diacetyloxy-[4-[3,5-bis(trifluoromethyl)phenyl]butyl]silyl] acetate (PubChem CID 90173511) has the molecular formula C18H20F6O6Si and a molecular weight of 474.43 g/mol. Its IUPAC name is [diacetyloxy-[4-[3,5-bis(trifluoromethyl)phenyl]butyl]silyl] acetate.
| Compound Name | [diacetyloxy-[4-[3,5-bis(trifluoromethyl)phenyl]butyl]silyl] acetate |
|---|---|
| PubChem CID | 90173511 |
| Molecular Formula | C18H20F6O6Si |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | [diacetyloxy-[4-[3,5-bis(trifluoromethyl)phenyl]butyl]silyl] acetate |
| SMILES | CC(=O)O[Si](CCCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C18H20F6O6Si/c1-11(25)28-31(29-12(2)26,30-13(3)27)7-5-4-6-14-8-15(17(19,20)21)10-16(9-14)18(22,23)24/h8-10H,4-7H2,1-3H3 |
| InChIKey | PMIOWLVHUBGNIF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|