C16H22F6O2Si — CID 90175393
5-[3,5-bis(trifluoromethyl)phenyl]pentyl-dimethoxy-methylsilane (PubChem CID 90175393) has the molecular formula C16H22F6O2Si and a molecular weight of 388.42 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]pentyl-dimethoxy-methylsilane.
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]pentyl-dimethoxy-methylsilane |
|---|---|
| PubChem CID | 90175393 |
| Molecular Formula | C16H22F6O2Si |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]pentyl-dimethoxy-methylsilane |
| SMILES | CO[Si](C)(CCCCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OC |
| InChI | InChI=1S/C16H22F6O2Si/c1-23-25(3,24-2)8-6-4-5-7-12-9-13(15(17,18)19)11-14(10-12)16(20,21)22/h9-11H,4-8H2,1-3H3 |
| InChIKey | GSRUZKZRVQCGAR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|