C17H27F3OSi — CID 90172777
diethyl-methoxy-[5-[3-(trifluoromethyl)phenyl]pentyl]silane (PubChem CID 90172777) has the molecular formula C17H27F3OSi and a molecular weight of 332.48 g/mol. Its IUPAC name is diethyl-methoxy-[5-[3-(trifluoromethyl)phenyl]pentyl]silane.
| Compound Name | diethyl-methoxy-[5-[3-(trifluoromethyl)phenyl]pentyl]silane |
|---|---|
| PubChem CID | 90172777 |
| Molecular Formula | C17H27F3OSi |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | diethyl-methoxy-[5-[3-(trifluoromethyl)phenyl]pentyl]silane |
| SMILES | CC[Si](CC)(CCCCCc1cccc(C(F)(F)F)c1)OC |
| InChI | InChI=1S/C17H27F3OSi/c1-4-22(5-2,21-3)13-8-6-7-10-15-11-9-12-16(14-15)17(18,19)20/h9,11-12,14H,4-8,10,13H2,1-3H3 |
| InChIKey | MGXRHCREKBYKPW-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|