C15H20F6OSi — CID 90172147
2-[3,5-bis(trifluoromethyl)phenyl]ethyl-diethyl-methoxysilane (PubChem CID 90172147) has the molecular formula C15H20F6OSi and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]ethyl-diethyl-methoxysilane.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]ethyl-diethyl-methoxysilane |
|---|---|
| PubChem CID | 90172147 |
| Molecular Formula | C15H20F6OSi |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]ethyl-diethyl-methoxysilane |
| SMILES | CC[Si](CC)(CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OC |
| InChI | InChI=1S/C15H20F6OSi/c1-4-23(5-2,22-3)7-6-11-8-12(14(16,17)18)10-13(9-11)15(19,20)21/h8-10H,4-7H2,1-3H3 |
| InChIKey | FJJQZCMVRBCNQF-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|