C19H28F6O3Si — CID 90171216
2-[3,5-bis(trifluoromethyl)phenyl]ethyl-tripropoxysilane (PubChem CID 90171216) has the molecular formula C19H28F6O3Si and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]ethyl-tripropoxysilane.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]ethyl-tripropoxysilane |
|---|---|
| PubChem CID | 90171216 |
| Molecular Formula | C19H28F6O3Si |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]ethyl-tripropoxysilane |
| SMILES | CCCO[Si](CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)(OCCC)OCCC |
| InChI | InChI=1S/C19H28F6O3Si/c1-4-8-26-29(27-9-5-2,28-10-6-3)11-7-15-12-16(18(20,21)22)14-17(13-15)19(23,24)25/h12-14H,4-11H2,1-3H3 |
| InChIKey | QAKSZDGPCCHCLV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|