C11H10F6O — CID 23395147
1-propoxy-3,5-bis(trifluoromethyl)benzene (PubChem CID 23395147) has the molecular formula C11H10F6O and a molecular weight of 272.19 g/mol. Its IUPAC name is 1-propoxy-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-propoxy-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 23395147 |
| Molecular Formula | C11H10F6O |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1-propoxy-3,5-bis(trifluoromethyl)benzene |
| SMILES | CCCOc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F6O/c1-2-3-18-9-5-7(10(12,13)14)4-8(6-9)11(15,16)17/h4-6H,2-3H2,1H3 |
| InChIKey | MQAXEOKVHDKGBQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |