C14H16F6O2 — CID 90004068
6-[3,5-bis(trifluoromethyl)phenoxy]hexan-1-ol (PubChem CID 90004068) has the molecular formula C14H16F6O2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 6-[3,5-bis(trifluoromethyl)phenoxy]hexan-1-ol.
| Compound Name | 6-[3,5-bis(trifluoromethyl)phenoxy]hexan-1-ol |
|---|---|
| PubChem CID | 90004068 |
| Molecular Formula | C14H16F6O2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 6-[3,5-bis(trifluoromethyl)phenoxy]hexan-1-ol |
| SMILES | OCCCCCCOc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F6O2/c15-13(16,17)10-7-11(14(18,19)20)9-12(8-10)22-6-4-2-1-3-5-21/h7-9,21H,1-6H2 |
| InChIKey | TUWHVYXWRJDHLO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|