C19H17F7O3 — CID 146557382
3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(4-fluorobutoxy)phenol (PubChem CID 146557382) has the molecular formula C19H17F7O3 and a molecular weight of 426.33 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(4-fluorobutoxy)phenol.
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(4-fluorobutoxy)phenol |
|---|---|
| PubChem CID | 146557382 |
| Molecular Formula | C19H17F7O3 |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-(4-fluorobutoxy)phenol |
| SMILES | Oc1cc(OCCCCF)cc(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H17F7O3/c20-3-1-2-4-28-16-8-15(27)9-17(10-16)29-11-12-5-13(18(21,22)23)7-14(6-12)19(24,25)26/h5-10,27H,1-4,11H2 |
| InChIKey | QFZCGWICSFCDTP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|